6-(2-chlorophenyl)sulfanyl-1-(2-hydroxyethoxymethyl)-5-methylpyrimidine-2,4-dione
Modify Date: 2025-08-29 19:52:53
6-(2-chlorophenyl)sulfanyl-1-(2-hydroxyethoxymethyl)-5-methylpyrimidine-2,4-dione structure
|
Common Name | 6-(2-chlorophenyl)sulfanyl-1-(2-hydroxyethoxymethyl)-5-methylpyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 125056-60-2 | Molecular Weight | 342.79800 | |
| Density | 1.47g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H15ClN2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(2-chlorophenyl)sulfanyl-1-(2-hydroxyethoxymethyl)-5-methylpyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Molecular Formula | C14H15ClN2O4S |
| Molecular Weight | 342.79800 |
| Exact Mass | 342.04400 |
| PSA | 109.88000 |
| LogP | 2.02830 |
| Index of Refraction | 1.653 |
| InChIKey | BJOXSPSZJASYLI-UHFFFAOYSA-N |
| SMILES | Cc1c(Sc2ccccc2Cl)n(COCCO)c(=O)[nH]c1=O |
|
~%
6-(2-chlorophen... CAS#:125056-60-2 |
| Literature: Tanaka, Hiromichi; Takashima, Hideaki; Ubasawa, Masaru; Sekiya, Kouichi; Nitta, Iasei; et al. Journal of Medicinal Chemistry, 1992 , vol. 35, # 2 p. 337 - 345 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,4(1H,3H)-Pyrimidinedione,6-[(2-chlorophenyl)thio]-1-[(2-hydroxyethoxy)methyl]-5-methyl |
| 6-((2-Chlorophenyl)thio)-1-((2-hydroxyethoxy)methyl)thymine |
| 2'-ClHEPT |