Pseudo Morphine (Morphine Impurity)
Modify Date: 2025-08-29 16:46:26
Pseudo Morphine (Morphine Impurity) structure
|
Common Name | Pseudo Morphine (Morphine Impurity) | ||
|---|---|---|---|---|
| CAS Number | 125-24-6 | Molecular Weight | 568.65900 | |
| Density | 1.58g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C34H36N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Pseudo Morphine (Morphine Impurity) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.58g/cm3 |
|---|---|
| Molecular Formula | C34H36N2O6 |
| Molecular Weight | 568.65900 |
| Exact Mass | 568.25700 |
| PSA | 105.86000 |
| LogP | 2.25240 |
| Index of Refraction | 1.803 |
| InChIKey | FOJYFDFNGPRXDR-SQILNHJXSA-N |
| SMILES | CN1CCC23c4c5cc(-c6cc7c8c(c6O)OC6C(O)C=CC9C(C7)N(C)CCC896)c(O)c4OC2C(O)C=CC3C1C5 |
| RIDADR | NONH for all modes of transport |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:121395-47-9| Pseudomorphine (Morphine Impurity) |
| Pseudomorpine |
| Dehydromorphin |
| Pseudomorphine (free base) |
| Morphine Sulfate Related Compound B CII (20 mg) (Pseudomorphine) |
| 4,5,4',5'-diepoxy-17,17'-dimethyl-[2,2']bimorphin-7-enyl-3,6,3',6'-tetraol |
| Pseudomorphin |