(2S,3S)-2,3-Dihydroxysuccinic acid-2-[(1S)-3-(diisopropylamino)-1-phenylpropyl]-4-methylphenol (1:1) structure
|
Common Name | (2S,3S)-2,3-Dihydroxysuccinic acid-2-[(1S)-3-(diisopropylamino)-1-phenylpropyl]-4-methylphenol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 124937-54-8 | Molecular Weight | 475.574 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H37NO7 | Melting Point | 207 - 209°C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2S,3S)-2,3-Dihydroxysuccinic acid-2-[(1S)-3-(diisopropylamino)-1-phenylpropyl]-4-methylphenol (1:1) |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 207 - 209°C |
|---|---|
| Molecular Formula | C26H37NO7 |
| Molecular Weight | 475.574 |
| Exact Mass | 475.256989 |
| Appearance of Characters | Solid,White to Off-White |
| InChIKey | TWHNMSJGYKMTRB-KAKIZCIRSA-N |
| SMILES | Cc1ccc(O)c(C(CCN(C(C)C)C(C)C)c2ccccc2)c1.O=C(O)C(O)C(O)C(=O)O |
| Storage condition | Refrigerator |
| (2S,3S)-2,3-Dihydroxysuccinic acid - 2-[(1S)-3-(diisopropylamino)-1-phenylpropyl]-4-methylphenol (1:1) |
| Butanedioic acid, 2,3-dihydroxy-, (2S,3S)-, compd. with 2-[(1S)-3-[bis(1-methylethyl)amino]-1-phenylpropyl]-4-methylphenol (1:1) |