Desmethyl VS-5584
Modify Date: 2025-08-27 12:07:48
Desmethyl VS-5584 structure
|
Common Name | Desmethyl VS-5584 | ||
|---|---|---|---|---|
| CAS Number | 1246535-95-4 | Molecular Weight | 340.383 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 669.3±65.0 °C at 760 mmHg | |
| Molecular Formula | C16H20N8O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 358.6±34.3 °C | |
Use of Desmethyl VS-5584Desmethyl-VS-5584 is a dimethyl analog of VS-5584 which is an potent and selective mTOR/PI3K dual inhibitor with pyrido [2,3-d] pyrimidine structure[1]. |
| Name | 5-(9-isopropyl-2-morpholino-9H-purin-6-yl)pyrimidin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Description | Desmethyl-VS-5584 is a dimethyl analog of VS-5584 which is an potent and selective mTOR/PI3K dual inhibitor with pyrido [2,3-d] pyrimidine structure[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 669.3±65.0 °C at 760 mmHg |
| Molecular Formula | C16H20N8O |
| Molecular Weight | 340.383 |
| Flash Point | 358.6±34.3 °C |
| Exact Mass | 340.175995 |
| PSA | 107.87000 |
| LogP | -0.67 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.766 |
| InChIKey | NGDDJJKHNGAOCH-UHFFFAOYSA-N |
| SMILES | CC(C)n1cnc2c(-c3cnc(N)nc3)nc(N3CCOCC3)nc21 |
| Storage condition | -20℃ |
| 2-Pyrimidinamine, 5-[9-(1-methylethyl)-2-(4-morpholinyl)-9H-purin-6-yl]- |
| 5-[9-Isopropyl-2-(4-morpholinyl)-9H-purin-6-yl]-2-pyrimidinamine |
| 5-(9-isopropyl-2-morpholin-4-yl-9H-purin-6-yl)-pyrimidin-2-ylamine |
| 5-(9-isopropyl-2-morpholin-4-yl-9H-purin-6-yl)pyrimidin-2-ylamine |
| Desmethyl VS-5584 |