Ludaterone structure
|
Common Name | Ludaterone | ||
|---|---|---|---|---|
| CAS Number | 124548-08-9 | Molecular Weight | 380.86 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H25ClO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of LudateroneLudaterone is an antiandrogen agent, with potent antiandrogenic activity[1]. |
| Name | Ludaterone |
|---|
| Description | Ludaterone is an antiandrogen agent, with potent antiandrogenic activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C20H25ClO5 |
|---|---|
| Molecular Weight | 380.86 |
| InChIKey | ZHSNBOJOKRJMQY-BVJLIMHSSA-N |
| SMILES | CC(=O)C1(O)CC(O)C2C3C=C(Cl)C4=CC(=O)OCC4(C)C3CCC21C |