alpha-acetamido-N-(4-fluorobenzyl)-alpha-(furan-2-yl)acetamide
Modify Date: 2025-09-20 10:30:26
alpha-acetamido-N-(4-fluorobenzyl)-alpha-(furan-2-yl)acetamide structure
|
Common Name | alpha-acetamido-N-(4-fluorobenzyl)-alpha-(furan-2-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 124421-36-9 | Molecular Weight | 290.29000 | |
| Density | 1.25g/cm3 | Boiling Point | 557.8ºC at 760mmHg | |
| Molecular Formula | C15H15FN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.1ºC | |
| Name | 2-acetamido-N-[(4-fluorophenyl)methyl]-2-(furan-2-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 557.8ºC at 760mmHg |
| Molecular Formula | C15H15FN2O3 |
| Molecular Weight | 290.29000 |
| Flash Point | 291.1ºC |
| Exact Mass | 290.10700 |
| PSA | 78.32000 |
| LogP | 3.59290 |
| Vapour Pressure | 1.78E-12mmHg at 25°C |
| Index of Refraction | 1.548 |
| InChIKey | LODZQBZYDDLTON-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(C(=O)NCc1ccc(F)cc1)c1ccco1 |
|
~%
alpha-acetamido... CAS#:124421-36-9 |
| Literature: Journal of Medicinal Chemistry, , vol. 33, # 3 p. 919 - 926 |
|
~%
alpha-acetamido... CAS#:124421-36-9 |
| Literature: Journal of Medicinal Chemistry, , vol. 33, # 3 p. 919 - 926 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-Furanacetamide,a-(acetylamino)-N-[(4-fluorophenyl)methyl] |
| Acnh-fbfa |