1-methyl-4-nitro-2-prop-2-enoxybenzene structure
|
Common Name | 1-methyl-4-nitro-2-prop-2-enoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 124317-01-7 | Molecular Weight | 193.19900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-4-nitro-2-prop-2-enoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H11NO3 |
|---|---|
| Molecular Weight | 193.19900 |
| Exact Mass | 193.07400 |
| PSA | 55.05000 |
| LogP | 2.99120 |
| InChIKey | CSVSKPNSMNFOQN-UHFFFAOYSA-N |
| SMILES | C=CCOc1cc([N+](=O)[O-])ccc1C |
|
~55%
1-methyl-4-nitr... CAS#:124317-01-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 33, # 2 p. 614 - 626 |
|
~%
1-methyl-4-nitr... CAS#:124317-01-7 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 12, # 11 p. 2867 - 2879 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Benzene,1-methyl-4-nitro-2-(2-propenyloxy) |