Mibenratide structure
|
Common Name | Mibenratide | ||
|---|---|---|---|---|
| CAS Number | 1239011-83-6 | Molecular Weight | 2097.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C87H129N27O30S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MibenratideMibenratide, a small cyclic peptide, is an adrenergic β1 receptor antagonist. Mibenratide can be used for heart failure research[1]. |
| Name | Mibenratide |
|---|
| Description | Mibenratide, a small cyclic peptide, is an adrenergic β1 receptor antagonist. Mibenratide can be used for heart failure research[1]. |
|---|---|
| Related Catalog | |
| Target |
Beta-1 adrenergic receptor |
| References |
| Molecular Formula | C87H129N27O30S2 |
|---|---|
| Molecular Weight | 2097.24 |
| InChIKey | CQXYENUJCPYPTI-LZUXSVOASA-N |
| SMILES | CC1NC(=O)C(CCC(=O)O)NC(=O)C(CC(=O)O)NC(=O)C(C)NC(=O)C(CCC(N)=O)NC(=O)C(C(C)C)NC(=O)C(Cc2ccccc2)NC(=O)C(CC(=O)O)NC(=O)C(CO)NC(=O)C2CSSCC(NC(=O)C(CCCNC(=N)N)NC(=O)C(CCCNC(=N)N)NC1=O)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CC(N)=O)C(=O)NC(CC(=O)O)C(=O)N1CCCC1C(=O)NC(CCCCN)C(=O)N2 |