4-chloro-2-methoxy-6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine structure
|
Common Name | 4-chloro-2-methoxy-6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 123794-64-9 | Molecular Weight | 324.75900 | |
| Density | 1.233g/cm3 | Boiling Point | 452.6ºC at 760 mmHg | |
| Molecular Formula | C15H17ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.5ºC | |
| Name | 4-chloro-2-methoxy-6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 452.6ºC at 760 mmHg |
| Molecular Formula | C15H17ClN2O4 |
| Molecular Weight | 324.75900 |
| Flash Point | 227.5ºC |
| Exact Mass | 324.08800 |
| PSA | 62.70000 |
| LogP | 2.75520 |
| Vapour Pressure | 5.93E-08mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | DRAURIOHXMXMFM-UHFFFAOYSA-N |
| SMILES | COc1nc(Cl)cc(Cc2cc(OC)c(OC)c(OC)c2)n1 |
|
~%
4-chloro-2-meth... CAS#:123794-64-9 |
| Literature: Botta; Artico; Massa; Gambacorta Journal of Heterocyclic Chemistry, 1989 , vol. 26, # 3 p. 883 - 884 |
|
~%
4-chloro-2-meth... CAS#:123794-64-9 |
| Literature: Botta; Artico; Massa; Gambacorta Journal of Heterocyclic Chemistry, 1989 , vol. 26, # 3 p. 883 - 884 |
| Pyrimidine,4-chloro-2-methoxy-6-((3,4,5-trimethoxyphenyl)methyl) |
| 4-Chloro-2-methoxy-6-(3,4,5-trimethoxy-benzyl)-pyrimidine |