methyl 2-(4-methylanilino)-2-(3-oxo-5-phenylfuran-2-yl)acetate
Modify Date: 2025-08-25 06:28:20
methyl 2-(4-methylanilino)-2-(3-oxo-5-phenylfuran-2-yl)acetate structure
|
Common Name | methyl 2-(4-methylanilino)-2-(3-oxo-5-phenylfuran-2-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 123784-32-7 | Molecular Weight | 337.36900 | |
| Density | 1.261g/cm3 | Boiling Point | 497.9ºC at 760mmHg | |
| Molecular Formula | C20H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.9ºC | |
| Name | methyl 2-(4-methylanilino)-2-(3-oxo-5-phenylfuran-2-yl)acetate |
|---|
| Density | 1.261g/cm3 |
|---|---|
| Boiling Point | 497.9ºC at 760mmHg |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.36900 |
| Flash Point | 254.9ºC |
| Exact Mass | 337.13100 |
| PSA | 64.63000 |
| LogP | 3.03050 |
| Vapour Pressure | 4.77E-10mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | XMFSLHIIMKEJDS-UHFFFAOYSA-N |
| SMILES | COC(=O)C(Nc1ccc(C)cc1)C1OC(c2ccccc2)=CC1=O |
|
~16%
methyl 2-(4-met... CAS#:123784-32-7 |
| Literature: Andreichikov, Yu. S.; Koz'minykh, V. O. Journal of Organic Chemistry USSR (English Translation), 1989 , vol. 25, # 3.2 p. 556 - 559 Zhurnal Organicheskoi Khimii, 1989 , vol. 25, # 3 p. 618 - 622 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |