Diarbarone
Modify Date: 2025-09-13 15:36:55
Diarbarone structure
|
Common Name | Diarbarone | ||
|---|---|---|---|---|
| CAS Number | 1233-70-1 | Molecular Weight | 304.34100 | |
| Density | 1.268g/cm3 | Boiling Point | 462.1ºC at 760mmHg | |
| Molecular Formula | C16H20N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.3ºC | |
| Name | N-[2-(diethylamino)ethyl]-4-hydroxy-2-oxochromene-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.268g/cm3 |
|---|---|
| Boiling Point | 462.1ºC at 760mmHg |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.34100 |
| Flash Point | 233.3ºC |
| Exact Mass | 304.14200 |
| PSA | 86.27000 |
| LogP | 2.14500 |
| Vapour Pressure | 2.46E-09mmHg at 25°C |
| Index of Refraction | 1.59 |
| InChIKey | OGWJLWKFDHLZHV-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNC(=O)c1c(O)c2ccccc2oc1=O |
| HS Code | 2924199090 |
|---|
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Diarbarone |
| Diarbarona |
| N-(2-(Diethylaminoethyl)-4-hydroxy-3-cumarincarboxamid |
| N-(2-diethylaminoethyl)-2-hydroxy-4-oxochromene-3-carboxamide |
| Diarbaronum |
| Diarbaron |
| N-(2-(Diethylamino)ethyl)-4-hydroxy-2-oxo-2H-1-benzopyran-3-carboxamide |