[(1S)-2-[(1S,2R,4S,4aR,8R,8aR)-4-acetyloxy-4a-(acetyloxymethyl)-8-hydroxy-1,2-dimethylspiro[3,4,6,7,8,8a-hexahydro-2H-naphthalene-5,2'-oxirane]-1-yl]-1-(5-oxo-2H-furan-3-yl)ethyl] (2S)-2-methylbutanoate structure
|
Common Name | [(1S)-2-[(1S,2R,4S,4aR,8R,8aR)-4-acetyloxy-4a-(acetyloxymethyl)-8-hydroxy-1,2-dimethylspiro[3,4,6,7,8,8a-hexahydro-2H-naphthalene-5,2'-oxirane]-1-yl]-1-(5-oxo-2H-furan-3-yl)ethyl] (2S)-2-methylbutanoate | ||
|---|---|---|---|---|
| CAS Number | 123297-96-1 | Molecular Weight | 550.63800 | |
| Density | 1.25g/cm3 | Boiling Point | 654.6ºC at 760mmHg | |
| Molecular Formula | C29H42O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.6ºC | |
| Name | [(1S)-2-[(1S,2R,4S,4aR,8R,8aR)-4-acetyloxy-4a-(acetyloxymethyl)-8-hydroxy-1,2-dimethylspiro[3,4,6,7,8,8a-hexahydro-2H-naphthalene-5,2'-oxirane]-1-yl]-1-(5-oxo-2H-furan-3-yl)ethyl] (2S)-2-methylbutanoate |
|---|
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 654.6ºC at 760mmHg |
| Molecular Formula | C29H42O10 |
| Molecular Weight | 550.63800 |
| Flash Point | 206.6ºC |
| Exact Mass | 550.27800 |
| PSA | 137.96000 |
| LogP | 2.88480 |
| Vapour Pressure | 6.54E-20mmHg at 25°C |
| Index of Refraction | 1.541 |
| InChIKey | DRXQFROYDPGCHB-HMDICYLKSA-N |
| SMILES | CCC(C)C(=O)OC(CC1(C)C(C)CC(OC(C)=O)C2(COC(C)=O)C1C(O)CCC21CO1)C1=CC(=O)OC1 |
|
~%
[(1S)-2-[(1S,2R... CAS#:123297-96-1 |
| Literature: Shimomura, Hiroko; Sashida, Yutaka; Ogawa, Kazunori Chemical and Pharmaceutical Bulletin, 1989 , vol. 37, # 4 p. 988 - 992 |
|
~%
[(1S)-2-[(1S,2R... CAS#:123297-96-1 |
| Literature: Shimomura, Hiroko; Sashida, Yutaka; Ogawa, Kazunori Chemical and Pharmaceutical Bulletin, 1989 , vol. 37, # 4 p. 988 - 992 |
|
~%
[(1S)-2-[(1S,2R... CAS#:123297-96-1 |
| Literature: Shimomura, Hiroko; Sashida, Yutaka; Ogawa, Kazunori Chemical and Pharmaceutical Bulletin, 1989 , vol. 37, # 4 p. 988 - 992 |