3-hydroxy-1,3-diphenylpentan-1-one
Modify Date: 2025-08-29 08:18:08
3-hydroxy-1,3-diphenylpentan-1-one structure
|
Common Name | 3-hydroxy-1,3-diphenylpentan-1-one | ||
|---|---|---|---|---|
| CAS Number | 122934-61-6 | Molecular Weight | 254.32400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-hydroxy-1,3-diphenylpentan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H18O2 |
|---|---|
| Molecular Weight | 254.32400 |
| Exact Mass | 254.13100 |
| PSA | 37.30000 |
| LogP | 3.55720 |
| InChIKey | CZWGNQLDDVLEQP-UHFFFAOYSA-N |
| SMILES | CCC(O)(CC(=O)c1ccccc1)c1ccccc1 |
|
~86%
3-hydroxy-1,3-d... CAS#:122934-61-6 |
| Literature: Tanabe, Yoo; Matsumoto, Noriaki; Higashi, Takahiro; Misaki, Tomonori; Itoh, Tomotaka; Yamamoto, Misako; Mitarai, Kumi; Nishii, Yoshinori Tetrahedron, 2002 , vol. 58, # 41 p. 8269 - 8280 |
|
~66%
3-hydroxy-1,3-d... CAS#:122934-61-6 |
| Literature: Hayashi, Masaji; Inubushi, Atsuro; Mukaiyama, Teruaki Bulletin of the Chemical Society of Japan, 1988 , vol. 61, # 11 p. 4037 - 4042 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-Pentanone,3-hydroxy-1,3-diphenyl |
| 3-hydroxy-1,3-diphenyl-1-pentanone |