4-Bromo-D-phenylalanine hydrochloride
Modify Date: 2025-08-24 22:26:59
4-Bromo-D-phenylalanine hydrochloride structure
|
Common Name | 4-Bromo-D-phenylalanine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 122852-33-9 | Molecular Weight | 280.54600 | |
| Density | N/A | Boiling Point | 394.9ºC at 760 mmHg | |
| Molecular Formula | C9H11BrClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.6ºC | |
| Name | (2R)-2-amino-3-(4-bromophenyl)propanoic acid,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 394.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C9H11BrClNO2 |
| Molecular Weight | 280.54600 |
| Flash Point | 192.6ºC |
| Exact Mass | 278.96600 |
| PSA | 63.32000 |
| LogP | 2.90580 |
| InChIKey | GRWMPXZZFAPLFZ-DDWIOCJRSA-N |
| SMILES | Cl.NC(Cc1ccc(Br)cc1)C(=O)O |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| (R)-4-Bromophenylalanine Hydrochloride Salt |
| 4-Bromo-D-phenylalanine hydrochloride |
| D-Phenylalanine,4-bromo-,hydrochloride (9CI) |