2-Phenyl-2-(2-piperidinoethyl)-3-methylvaleronitrile
Modify Date: 2025-11-25 11:30:23
2-Phenyl-2-(2-piperidinoethyl)-3-methylvaleronitrile structure
|
Common Name | 2-Phenyl-2-(2-piperidinoethyl)-3-methylvaleronitrile | ||
|---|---|---|---|---|
| CAS Number | 1228-02-0 | Molecular Weight | 284.43900 | |
| Density | 0.982g/cm3 | Boiling Point | 421.7ºC at 760 mmHg | |
| Molecular Formula | C19H28N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174ºC | |
| Name | 3-methyl-2-phenyl-2-(2-piperidin-1-ylethyl)pentanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 0.982g/cm3 |
|---|---|
| Boiling Point | 421.7ºC at 760 mmHg |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.43900 |
| Flash Point | 174ºC |
| Exact Mass | 284.22500 |
| PSA | 27.03000 |
| LogP | 4.30798 |
| Vapour Pressure | 2.55E-07mmHg at 25°C |
| Index of Refraction | 1.517 |
| InChIKey | JHWFWJSHRYEDOF-UHFFFAOYSA-N |
| SMILES | CCC(C)C(C#N)(CCN1CCCCC1)c1ccccc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-methyl-2-phenyl-2-(2-piperidin-1-yl-ethyl)-pentanenitrile |
| Valeronitrile,3-methyl-2-phenyl-2-(2-piperidinoethyl) |
| 2-Phenyl-2-(1-methylpropyl)-4-piperidinobutyronitril |
| 2-Phenyl-2-(2-piperidinoethyl)-3-methylvaleronitrile |
| Valeronitrile,2-phenyl-2-(2-piperidinoethyl)-3-methyl |