Methyl 5-bromo-1H-indole-6-carboxylate
Modify Date: 2025-09-12 11:28:26
Methyl 5-bromo-1H-indole-6-carboxylate structure
|
Common Name | Methyl 5-bromo-1H-indole-6-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1227267-28-8 | Molecular Weight | 254.080 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 378.8±22.0 °C at 760 mmHg | |
| Molecular Formula | C10H8BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.9±22.3 °C | |
| Name | Methyl 5-bromo-1H-indole-6-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 378.8±22.0 °C at 760 mmHg |
| Molecular Formula | C10H8BrNO2 |
| Molecular Weight | 254.080 |
| Flash Point | 182.9±22.3 °C |
| Exact Mass | 252.973831 |
| PSA | 42.09000 |
| LogP | 2.56 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.666 |
| InChIKey | IIOVQDYEEGSQRC-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc2[nH]ccc2cc1Br |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Bromo indole-6-carboxylic acid methyl ester |
| 1H-Indole-6-carboxylic acid, 5-bromo-, methyl ester |
| I10-1091 |
| Methyl 5-bromo-1H-indole-6-carboxylate |