2-bromo-6-methoxy-5-(trifluoromethyl)naphthalene-1-carboxylic acid
Modify Date: 2024-01-18 18:06:14
2-bromo-6-methoxy-5-(trifluoromethyl)naphthalene-1-carboxylic acid structure
|
Common Name | 2-bromo-6-methoxy-5-(trifluoromethyl)naphthalene-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 122670-62-6 | Molecular Weight | 349.10000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8BrF3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-bromo-6-methoxy-5-(trifluoromethyl)naphthalene-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H8BrF3O3 |
|---|---|
| Molecular Weight | 349.10000 |
| Exact Mass | 347.96100 |
| PSA | 46.53000 |
| LogP | 4.32790 |
| InChIKey | QNLRUNZHUBXUHC-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(C(=O)O)c(Br)ccc2c1C(F)(F)F |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-Naphthalenecarboxylic acid,2-bromo-6-methoxy-5-(trifluoromethyl) |
| 2-Bromo-6-methoxy-5-(trifluoromethyl)-1-naphthoic acid |