6-(2-amino-1-hydroxypropan-2-yl)-5,6,7,8-tetrahydronaphthalen-2-ol
Modify Date: 2025-08-25 20:09:29
6-(2-amino-1-hydroxypropan-2-yl)-5,6,7,8-tetrahydronaphthalen-2-ol structure
|
Common Name | 6-(2-amino-1-hydroxypropan-2-yl)-5,6,7,8-tetrahydronaphthalen-2-ol | ||
|---|---|---|---|---|
| CAS Number | 1225228-92-1 | Molecular Weight | 221.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(2-amino-1-hydroxypropan-2-yl)-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|
| Molecular Formula | C13H19NO2 |
|---|---|
| Molecular Weight | 221.29500 |
| Exact Mass | 221.14200 |
| PSA | 66.48000 |
| LogP | 1.90710 |
| InChIKey | ROQUHQOMQGBKNK-UHFFFAOYSA-N |
| SMILES | CC(N)(CO)C1CCc2cc(O)ccc2C1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |