3-Ethoxy-2-(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-2-methyl-3-oxopropanoic acid structure
|
Common Name | 3-Ethoxy-2-(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-2-methyl-3-oxopropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 1225228-89-6 | Molecular Weight | 306.35400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Ethoxy-2-(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-2-methyl-3-oxopropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H22O5 |
|---|---|
| Molecular Weight | 306.35400 |
| Exact Mass | 306.14700 |
| PSA | 72.83000 |
| LogP | 2.45410 |
| InChIKey | NYKDPNQDSCCMMR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C(=O)O)C1CCc2cc(OC)ccc2C1 |
| HS Code | 2918990090 |
|---|
|
~%
3-Ethoxy-2-(6-m... CAS#:1225228-89-6 |
| Literature: BIOGEN IDEC MA INC.; GUCKIAN, Kevin, M.; CALDWELL, Richard, D.; KUMARAVEL, Gnanasambandam; LEE, Wen-cherng; LIN, Edward, Yin-shiang; LIU, Xiaogao; MA, Bin; SCOTT, Daniel, M.; SHI, Zhan; ZHENG, Guo, Zhu; TAVERAS, Arthur, G.; THOMAS, Jermaine Patent: WO2010/51031 A1, 2010 ; Location in patent: Page/Page column 22-23 ; WO 2010/051031 A1 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-methyl-3-ethoxy-2-(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-3-oxopropanoic acid |