7,8-dihydroxy-5,6-epoxy-1,4-dimethyl-5,6,7,8-tetrahydrophenanthrene
Modify Date: 2025-01-23 20:08:41
7,8-dihydroxy-5,6-epoxy-1,4-dimethyl-5,6,7,8-tetrahydrophenanthrene structure
|
Common Name | 7,8-dihydroxy-5,6-epoxy-1,4-dimethyl-5,6,7,8-tetrahydrophenanthrene | ||
|---|---|---|---|---|
| CAS Number | 122033-85-6 | Molecular Weight | 256.29600 | |
| Density | 1.372g/cm3 | Boiling Point | 495.2ºC at 760mmHg | |
| Molecular Formula | C16H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.3ºC | |
| Name | 6,9-Dimethyl-1a,2,3,9c-tetrahydrophenanthro[3,4-b]oxirene-2,3-dio l |
|---|
| Density | 1.372g/cm3 |
|---|---|
| Boiling Point | 495.2ºC at 760mmHg |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.29600 |
| Flash Point | 253.3ºC |
| Exact Mass | 256.11000 |
| PSA | 52.99000 |
| LogP | 2.30440 |
| Vapour Pressure | 1.27E-10mmHg at 25°C |
| Index of Refraction | 1.715 |
| InChIKey | LZNNOIOAISZOEX-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C)c2c3c(ccc12)C(O)C(O)C1OC31 |
|
~94%
7,8-dihydroxy-5... CAS#:122033-85-6 |
| Literature: Koreeda, Masato; Jung, Kee-Yong; Hirota, Mitsuru Journal of the American Chemical Society, 1990 , vol. 112, # 20 p. 7413 - 7414 |
![(7R,7aS,10aS,11S)-11-bromo-7-hydroxy-1,4-dimethyl-7,7a,10a,11-tetrahydrophenanthro[2,3-d][1,3]dioxol-9-one structure](https://image.chemsrc.com/caspic/454/122033-86-7.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |