Ethyl 3-amino-4-{[3-(dimethylamino)propyl]-amino}benzoate hydrochloride
Modify Date: 2025-08-25 23:26:32
![Ethyl 3-amino-4-{[3-(dimethylamino)propyl]-amino}benzoate hydrochloride Structure](https://image.chemsrc.com/caspic/479/1220036-40-7.png)
Ethyl 3-amino-4-{[3-(dimethylamino)propyl]-amino}benzoate hydrochloride structure
|
Common Name | Ethyl 3-amino-4-{[3-(dimethylamino)propyl]-amino}benzoate hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1220036-40-7 | Molecular Weight | 301.81200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H24ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 3-amino-4-{[3-(dimethylamino)propyl]-amino}benzoate hydrochloride |
|---|
| Molecular Formula | C14H24ClN3O2 |
|---|---|
| Molecular Weight | 301.81200 |
| Exact Mass | 301.15600 |
| PSA | 67.59000 |
| LogP | 3.26530 |
| InChIKey | LVPXKHCZSQEANM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(NCCCN(C)C)c(N)c1.Cl |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |