Benzeneacetic acid,3-methylphenyl ester
Modify Date: 2025-08-25 19:50:09
Benzeneacetic acid,3-methylphenyl ester structure
|
Common Name | Benzeneacetic acid,3-methylphenyl ester | ||
|---|---|---|---|---|
| CAS Number | 122-27-0 | Molecular Weight | 226.27000 | |
| Density | 1.108g/cm3 | Boiling Point | 359.1ºC at 760mmHg | |
| Molecular Formula | C15H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 122.2ºC | |
| Name | (3-methylphenyl) 2-phenylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.108g/cm3 |
|---|---|
| Boiling Point | 359.1ºC at 760mmHg |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.27000 |
| Flash Point | 122.2ºC |
| Exact Mass | 226.09900 |
| PSA | 26.30000 |
| LogP | 3.14310 |
| Vapour Pressure | 2.44E-05mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | LSWZGOVODYFNQO-UHFFFAOYSA-N |
| SMILES | Cc1cccc(OC(=O)Cc2ccccc2)c1 |
| HS Code | 2916399090 |
|---|
|
~93%
Benzeneacetic a... CAS#:122-27-0 |
| Literature: Chhor, Rakeshwar B.; Singh, Kunwar A.; Nosse; Tandon, Vishnu K. Synthetic Communications, 2003 , vol. 33, # 14 p. 2519 - 2530 |
|
~4%
Benzeneacetic a... CAS#:122-27-0 |
| Literature: Martin, Robert; Lafrance, Jean Ronald; Demerseman, Pierre Bulletin des Societes Chimiques Belges, 1991 , vol. 100, # 7 p. 539 - 548 |
|
~%
Benzeneacetic a... CAS#:122-27-0 |
| Literature: Rosenmund; Schnurr Justus Liebigs Annalen der Chemie, 1928 , vol. 460, p. 89 |
|
~%
Benzeneacetic a... CAS#:122-27-0 |
| Literature: Rosenmund; Schnurr Justus Liebigs Annalen der Chemie, 1928 , vol. 460, p. 89 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Phenylacetic acid,3-methylphenyl ester |
| Phenyl-essigsaeure-m-tolylester |
| m-Tolyl phenylacetate |
| meta-Tolyl phenylacetate |
| EINECS 204-531-0 |
| Benzeneacetic acid,3-methylphenyl ester |
| 3-methylphenyl phenylacetate |
| m-Cresyl phenylacetate |
| Phenylacetic acid,m-tolyl ester |