Ethyl 3-amino-4-[(2-methoxyethyl)amino]benzoate
Modify Date: 2025-08-29 09:26:32
![Ethyl 3-amino-4-[(2-methoxyethyl)amino]benzoate Structure](https://image.chemsrc.com/caspic/200/1219957-49-9.png)
Ethyl 3-amino-4-[(2-methoxyethyl)amino]benzoate structure
|
Common Name | Ethyl 3-amino-4-[(2-methoxyethyl)amino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 1219957-49-9 | Molecular Weight | 238.28300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 3-amino-4-[(2-methoxyethyl)amino]benzoate |
|---|
| Molecular Formula | C12H18N2O3 |
|---|---|
| Molecular Weight | 238.28300 |
| Exact Mass | 238.13200 |
| PSA | 73.58000 |
| LogP | 2.15800 |
| InChIKey | PVZOGMQQRGQIIR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(NCCOC)c(N)c1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |