4-(3-hydroxy-2,3-dimethylcyclopentyl)pent-4-enyl acetate
Modify Date: 2025-11-10 02:57:55
4-(3-hydroxy-2,3-dimethylcyclopentyl)pent-4-enyl acetate structure
|
Common Name | 4-(3-hydroxy-2,3-dimethylcyclopentyl)pent-4-enyl acetate | ||
|---|---|---|---|---|
| CAS Number | 121979-32-6 | Molecular Weight | 240.33900 | |
| Density | 1.004g/cm3 | Boiling Point | 294.6ºC at 760mmHg | |
| Molecular Formula | C14H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 108.4ºC | |
| Name | 4-(3-hydroxy-2,3-dimethylcyclopentyl)pent-4-enyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.004g/cm3 |
|---|---|
| Boiling Point | 294.6ºC at 760mmHg |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.33900 |
| Flash Point | 108.4ºC |
| Exact Mass | 240.17300 |
| PSA | 46.53000 |
| LogP | 2.68300 |
| Vapour Pressure | 0.000168mmHg at 25°C |
| Index of Refraction | 1.477 |
| InChIKey | QGPXLWRTRLEOMJ-UHFFFAOYSA-N |
| SMILES | C=C(CCCOC(C)=O)C1CCC(C)(O)C1C |
|
~%
4-(3-hydroxy-2,... CAS#:121979-32-6 |
| Literature: Koshino, Hiroyuki; Togiya, Satoshi; Terada, Shun-ichi; Yoshihara, Teruhiko; Sakamura, Sadao; et al. Agricultural and Biological Chemistry, 1989 , vol. 53, # l p. 789 - 796 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Chokol F |
| 4-(3-hydroxy-2,3-dimethylcyclopentyl)pent-4-en-1-yl acetate |