(R)-1-((R)-tert-butylsulfinyl)-2-(4-fluorophenyl)pyrrolidine
Modify Date: 2025-11-27 17:04:16
(R)-1-((R)-tert-butylsulfinyl)-2-(4-fluorophenyl)pyrrolidine structure
|
Common Name | (R)-1-((R)-tert-butylsulfinyl)-2-(4-fluorophenyl)pyrrolidine | ||
|---|---|---|---|---|
| CAS Number | 1218989-47-9 | Molecular Weight | 269.37800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20FNOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2R)-1-[(R)-tert-butylsulfinyl]-2-(4-fluorophenyl)pyrrolidine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H20FNOS |
|---|---|
| Molecular Weight | 269.37800 |
| Exact Mass | 269.12500 |
| PSA | 39.52000 |
| LogP | 4.22840 |
| InChIKey | SOHDPWOODHXWCS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)S(=O)N1CCCC1c1ccc(F)cc1 |
| HS Code | 2933990090 |
|---|
|
~95%
(R)-1-((R)-tert... CAS#:1218989-47-9 |
| Literature: Reddy, Leleti Rajender; Das, Sonia G.; Liu, Yugang; Prashad, Mahavir Journal of Organic Chemistry, 2010 , vol. 75, # 7 p. 2236 - 2246 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (R)-1-((S)-2-methyl-propane-2-sulfinyl)-2-(4-fluorophenyl)-pyrrolidine |
| (R)-1-((R)-tert-butylsulfinyl)-2-(4-fluorophenyl)pyrrolidine |