3-(4-ethoxyphenyl)pyrido[3,4-e][1,2,4]triazine structure
|
Common Name | 3-(4-ethoxyphenyl)pyrido[3,4-e][1,2,4]triazine | ||
|---|---|---|---|---|
| CAS Number | 121845-63-4 | Molecular Weight | 252.27100 | |
| Density | 1.247g/cm3 | Boiling Point | 468.8ºC at 760mmHg | |
| Molecular Formula | C14H12N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.6ºC | |
| Name | 3-(4-ethoxyphenyl)pyrido[3,4-e][1,2,4]triazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.247g/cm3 |
|---|---|
| Boiling Point | 468.8ºC at 760mmHg |
| Molecular Formula | C14H12N4O |
| Molecular Weight | 252.27100 |
| Flash Point | 167.6ºC |
| Exact Mass | 252.10100 |
| PSA | 60.79000 |
| LogP | 2.48550 |
| Vapour Pressure | 1.63E-08mmHg at 25°C |
| Index of Refraction | 1.634 |
| InChIKey | VQLHQAWJTBFBDQ-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(-c2nnc3ccncc3n2)cc1 |
|
~%
3-(4-ethoxyphen... CAS#:121845-63-4 |
| Literature: Reich; Fabio; Lee; Kuck; Testa Journal of Medicinal Chemistry, 1989 , vol. 32, # 11 p. 2474 - 2485 |
|
~%
3-(4-ethoxyphen... CAS#:121845-63-4 |
| Literature: Reich; Fabio; Lee; Kuck; Testa Journal of Medicinal Chemistry, 1989 , vol. 32, # 11 p. 2474 - 2485 |
|
~%
3-(4-ethoxyphen... CAS#:121845-63-4 |
| Literature: Reich; Fabio; Lee; Kuck; Testa Journal of Medicinal Chemistry, 1989 , vol. 32, # 11 p. 2474 - 2485 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-(4-Ethoxy-phenyl)-pyrido(3,4-e)(1,2,4)triazine |
| Pyrido[3,4-e]-1,2,4-triazine,3-(4-ethoxyphenyl) |