N,N-dimethyl-4-pyrido[3,4-e][1,2,4]triazin-3-ylaniline structure
|
Common Name | N,N-dimethyl-4-pyrido[3,4-e][1,2,4]triazin-3-ylaniline | ||
|---|---|---|---|---|
| CAS Number | 121845-62-3 | Molecular Weight | 251.28700 | |
| Density | 1.258g/cm3 | Boiling Point | 478.8ºC at 760mmHg | |
| Molecular Formula | C14H13N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.4ºC | |
| Name | N,N-dimethyl-4-pyrido[3,4-e][1,2,4]triazin-3-ylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.258g/cm3 |
|---|---|
| Boiling Point | 478.8ºC at 760mmHg |
| Molecular Formula | C14H13N5 |
| Molecular Weight | 251.28700 |
| Flash Point | 243.4ºC |
| Exact Mass | 251.11700 |
| PSA | 54.80000 |
| LogP | 2.15280 |
| Vapour Pressure | 2.49E-09mmHg at 25°C |
| Index of Refraction | 1.678 |
| InChIKey | VMCOUAAPOBDSCN-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(-c2nnc3ccncc3n2)cc1 |
|
~%
N,N-dimethyl-4-... CAS#:121845-62-3 |
| Literature: Reich; Fabio; Lee; Kuck; Testa Journal of Medicinal Chemistry, 1989 , vol. 32, # 11 p. 2474 - 2485 |
|
~%
N,N-dimethyl-4-... CAS#:121845-62-3 |
| Literature: Reich; Fabio; Lee; Kuck; Testa Journal of Medicinal Chemistry, 1989 , vol. 32, # 11 p. 2474 - 2485 |
|
~%
N,N-dimethyl-4-... CAS#:121845-62-3 |
| Literature: Reich; Fabio; Lee; Kuck; Testa Journal of Medicinal Chemistry, 1989 , vol. 32, # 11 p. 2474 - 2485 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Dimethyl-(4-pyrido(3,4-e)(1,2,4)triazin-3-yl-phenyl)-amine |
| Pyrido[3,4-e]-1,2,4-triazine,benzenamine deriv. |
| Benzenamine,N,N-dimethyl-4-pyrido[3,4-e]-1,2,4-triazin-3-yl |