8-bromo-2-phenylchromen-4-one
Modify Date: 2025-08-26 14:12:43
8-bromo-2-phenylchromen-4-one structure
|
Common Name | 8-bromo-2-phenylchromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 1218-52-6 | Molecular Weight | 301.13500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H9BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-bromo-2-phenylchromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H9BrO2 |
|---|---|
| Molecular Weight | 301.13500 |
| Exact Mass | 299.97900 |
| PSA | 30.21000 |
| LogP | 4.22250 |
| InChIKey | JYGLPGPPIWXVQD-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2ccccc2)oc2c(Br)cccc12 |
| HS Code | 2914700090 |
|---|
|
~75%
8-bromo-2-pheny... CAS#:1218-52-6 |
| Literature: Fitzmaurice, Richard J.; Etheridge, Zac C.; Jumel, Emelie; Woolfson, Derek N.; Caddick, Stephen Chemical Communications, 2006 , # 46 p. 4814 - 4816 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:87241-87-0| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 8-Brom-flavon |
| 8-BROMO-2-PHENYL-4H-1-BENZOPYRAN-4-ONE |
| 8-BROMO-2-PHENYL-4H-CHROMEN-4-ONE |
| 8-bromoflavone |
| 8-bromo-2-phenyl-chromen-4-one |