(R)-(+)-5'-Hydroxyphenyl Carvedilol structure
|
Common Name | (R)-(+)-5'-Hydroxyphenyl Carvedilol | ||
|---|---|---|---|---|
| CAS Number | 1217757-71-5 | Molecular Weight | 422.47400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H26N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (R)-(+)-5'-Hydroxyphenyl Carvedilol(R)-(+)-5'-Hydroxyphenyl Carvedilol is an active metabolite of Carvedilol, which is a nonselective -adrenergic blocker with α1-blocking activity. |
| Name | (R)-(+)-5'-Hydroxyphenyl Carvedilol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H26N2O5 |
|---|---|
| Molecular Weight | 422.47400 |
| Exact Mass | 422.18400 |
| PSA | 95.97000 |
| LogP | 3.83450 |
| InChIKey | PVUVZUBTCLBJMT-QGZVFWFLSA-N |
| SMILES | COc1ccc(O)cc1OCCNCC(O)COc1cccc2[nH]c3ccccc3c12 |
| 3-[2-[[(2R)-3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]amino]ethoxy]-4-methoxyphenol |