Zafirlukast-d7 structure
|
Common Name | Zafirlukast-d7 | ||
|---|---|---|---|---|
| CAS Number | 1217174-18-9 | Molecular Weight | 582.72 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H26D7N3O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Zafirlukast-d7Zafirlukast-d7 (ICI 204219-d7) is the deuterium labeled Zafirlukast. Zafirlukast (ICI 204219) is a potent orally active leukotriene D4 (LTD4) receptor antagonist. Zafirlukast shows anti-asthmatic, anti-inflammatory and anti-bacterial effects[1][2]. |
| Name | Zafirlukast-d7 |
|---|
| Description | Zafirlukast-d7 (ICI 204219-d7) is the deuterium labeled Zafirlukast. Zafirlukast (ICI 204219) is a potent orally active leukotriene D4 (LTD4) receptor antagonist. Zafirlukast shows anti-asthmatic, anti-inflammatory and anti-bacterial effects[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C31H26D7N3O6S |
|---|---|
| Molecular Weight | 582.72 |
| InChIKey | YEEZWCHGZNKEEK-WRQTXKASSA-N |
| SMILES | COc1cc(C(=O)NS(=O)(=O)c2ccccc2C)ccc1Cc1cn(C)c2ccc(NC(=O)OC3CCCC3)cc12 |