(2S)-2-amino-5-hydroxy-5-oxopentanoate,iron(2+) structure
|
Common Name | (2S)-2-amino-5-hydroxy-5-oxopentanoate,iron(2+) | ||
|---|---|---|---|---|
| CAS Number | 12170-54-6 | Molecular Weight | 348.08800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H16FeN2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2S)-2-amino-5-hydroxy-5-oxopentanoate,iron(2+) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H16FeN2O8 |
|---|---|
| Molecular Weight | 348.08800 |
| Exact Mass | 348.02600 |
| PSA | 206.90000 |
| InChIKey | XXDVUVPHJGZWQC-QHTZZOMLSA-L |
| SMILES | NC(CCC(=O)O)C(=O)[O-].NC(CCC(=O)O)C(=O)[O-].[Fe+2] |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Iron(II) diglutamate |
| Iron,bis(hydrogen glutamato) |
| UNII-NK5255J7U8 |
| ferrous bisglutamate |
| Ferrate(2-),bis(l-glutamato(1-)-kappaN,kappaO1)-,hydrogen (1:2),(t-4) |
| L-Glutamic acid,iron(2) salt |
| L-Glutamic acid,iron complex |