[(Z)-2-chloro-1-(2,5-dichlorophenyl)ethenoxy]-dimethoxy-sulfanylidene-λ5-phosphane structure
|
Common Name | [(Z)-2-chloro-1-(2,5-dichlorophenyl)ethenoxy]-dimethoxy-sulfanylidene-λ5-phosphane | ||
|---|---|---|---|---|
| CAS Number | 1217-91-0 | Molecular Weight | 347.58200 | |
| Density | 1.468g/cm3 | Boiling Point | 378.9ºC at 760 mmHg | |
| Molecular Formula | C10H10Cl3O3PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.9ºC | |
| Name | [(Z)-2-chloro-1-(2,5-dichlorophenyl)ethenoxy]-dimethoxy-sulfanylidene-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.468g/cm3 |
|---|---|
| Boiling Point | 378.9ºC at 760 mmHg |
| Molecular Formula | C10H10Cl3O3PS |
| Molecular Weight | 347.58200 |
| Flash Point | 182.9ºC |
| Exact Mass | 345.91500 |
| PSA | 69.59000 |
| LogP | 5.71510 |
| Vapour Pressure | 1.33E-05mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | PPQCNIKKOJIVFW-POHAHGRESA-N |
| SMILES | COP(=S)(OC)OC(=CCl)c1cc(Cl)ccc1Cl |
| HS Code | 2920190090 |
|---|
| HS Code | 2920190090 |
|---|---|
| Summary | 2920190090 other thiophosphoric esters (phosphorothioates) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Shell SD-9097 |
| ENT 27,118 |
| Phosphorothioic acid,O-(2-chloro-1-(2,5-dichlorophenyl)ethenyl) O,O-dimethyl ester |
| Phosphorothioic acid,O-(2-cloro-1-(2,5-dichlorophenyl)ethenyl) O,O-dimethyl ester |
| Phosphorothioic acid,O-(2-chloro-1-(2,5-dichlorophenyl)vinyl) O,O-dimethyl ester |
| SD 9097 |