Ethanone,1-(5-oxido-10H-phenothiazin-10-yl)-
Modify Date: 2025-09-19 23:28:02
Ethanone,1-(5-oxido-10H-phenothiazin-10-yl)- structure
|
Common Name | Ethanone,1-(5-oxido-10H-phenothiazin-10-yl)- | ||
|---|---|---|---|---|
| CAS Number | 1217-37-4 | Molecular Weight | 257.30800 | |
| Density | 1.44g/cm3 | Boiling Point | 551ºC at 760mmHg | |
| Molecular Formula | C14H11NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287ºC | |
| Name | 1-(5-oxophenothiazin-10-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 551ºC at 760mmHg |
| Molecular Formula | C14H11NO2S |
| Molecular Weight | 257.30800 |
| Flash Point | 287ºC |
| Exact Mass | 257.05100 |
| PSA | 56.59000 |
| LogP | 3.78200 |
| Vapour Pressure | 3.45E-12mmHg at 25°C |
| Index of Refraction | 1.738 |
| InChIKey | SZLYHEJOJMRRFR-UHFFFAOYSA-N |
| SMILES | CC(=O)N1c2ccccc2S(=O)c2ccccc21 |
| HS Code | 2934300000 |
|---|
| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 10-acetyl-10H-phenothiazine 5-oxide |
| 10-Acetyl-phenothiazin-5-oxid |
| Phenothiazine,10-acetyl-,5-oxide |
| 10-acetyl-phenothiazine-5-oxide |
| 10-Acetylphenothiazine-S-oxide |
| 9-Acetyl-phenothiazin-10-oxid |
| sulfoxyde de N-acetyl phenothiazine |