N',N'-dimethyl-N-(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl)propane-1,3-diamine structure
|
Common Name | N',N'-dimethyl-N-(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl)propane-1,3-diamine | ||
|---|---|---|---|---|
| CAS Number | 121593-92-8 | Molecular Weight | 285.42700 | |
| Density | 1.08g/cm3 | Boiling Point | 456ºC at 760 mmHg | |
| Molecular Formula | C18H27N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.6ºC | |
| Name | N',N'-dimethyl-N-(6-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-yl)propane-1,3-diamine |
|---|
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 456ºC at 760 mmHg |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.42700 |
| Flash Point | 229.6ºC |
| Exact Mass | 285.22000 |
| PSA | 31.06000 |
| LogP | 3.78590 |
| Vapour Pressure | 1.68E-08mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | ABYBKVTTZUTOKN-UHFFFAOYSA-N |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CCCC3NCCCN(C)C |
| HS Code | 2933990090 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |