tert-Butyl (3,3-difluorocyclopentyl)carbaMate structure
|
Common Name | tert-Butyl (3,3-difluorocyclopentyl)carbaMate | ||
|---|---|---|---|---|
| CAS Number | 1215071-23-0 | Molecular Weight | 221.244 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 273.9±40.0 °C at 760 mmHg | |
| Molecular Formula | C10H17F2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 119.5±27.3 °C | |
| Name | 2-Methyl-2-propanyl (3,3-difluorocyclopentyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 273.9±40.0 °C at 760 mmHg |
| Molecular Formula | C10H17F2NO2 |
| Molecular Weight | 221.244 |
| Flash Point | 119.5±27.3 °C |
| Exact Mass | 221.122742 |
| PSA | 41.82000 |
| LogP | 1.64 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.438 |
| InChIKey | SCXQXMBCRMLPGO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC(F)(F)C1 |
| HS Code | 2924299090 |
|---|
|
~92%
tert-Butyl (3,3... CAS#:1215071-23-0 |
| Literature: TAKEDA PHARMACEUTICAL COMPANY LIMITED; DONG, Qing; LAWSON, John, David; WALLACE, Michael, B.; KANOUNI, Toufike Patent: WO2010/144486 A1, 2010 ; Location in patent: Page/Page column 94-95 ; WO 2010/144486 A1 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Carbamic acid, N-(3,3-difluorocyclopentyl)-, 1,1-dimethylethyl ester |
| N-t-BOC-3,3-Difluorocyclopentylamine |
| tert-Butyl (3,3-difluorocyclopentyl)carbamate |
| 2-Methyl-2-propanyl (3,3-difluorocyclopentyl)carbamate |