α-(Thiobenzoyl)acetophenone
Modify Date: 2025-09-18 10:05:32
α-(Thiobenzoyl)acetophenone structure
|
Common Name | α-(Thiobenzoyl)acetophenone | ||
|---|---|---|---|---|
| CAS Number | 1215-43-6 | Molecular Weight | 240.32000 | |
| Density | 1.173g/cm3 | Boiling Point | 390.6ºC at 760 mmHg | |
| Molecular Formula | C15H12OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190ºC | |
| Name | 1,3-diphenyl-3-sulfanylidenepropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.173g/cm3 |
|---|---|
| Boiling Point | 390.6ºC at 760 mmHg |
| Molecular Formula | C15H12OS |
| Molecular Weight | 240.32000 |
| Flash Point | 190ºC |
| Exact Mass | 240.06100 |
| PSA | 49.16000 |
| LogP | 3.67760 |
| Vapour Pressure | 2.62E-06mmHg at 25°C |
| Index of Refraction | 1.633 |
| InChIKey | CELMQLYNQRJGQX-UHFFFAOYSA-N |
| SMILES | O=C(CC(=S)c1ccccc1)c1ccccc1 |
| HS Code | 2930909090 |
|---|
|
~72%
α-(Thiobenzoyl)... CAS#:1215-43-6 |
| Literature: Dalton Transactions, , vol. 43, # 3 p. 1279 - 1291 |
|
~20%
α-(Thiobenzoyl)... CAS#:1215-43-6 |
| Literature: Journal fuer Praktische Chemie (Leipzig), , vol. 332, # 2 p. 148 - 160 |
|
~%
α-(Thiobenzoyl)... CAS#:1215-43-6 |
| Literature: Annali di Chimica (Rome, Italy), , vol. 48, p. 581,585, 586 |
|
~%
α-(Thiobenzoyl)... CAS#:1215-43-6 |
| Literature: Journal of the Chemical Society, Chemical Communications, , # 7 p. 401 - 402 |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,3-Diphenyl-3-thioxopropane-1-one |
| 5020P |
| Benzoyl(thiobenzoyl)methane |
| 1,3-Diphenyl-3-thioxo-1-propanon |
| PhCSCH2COPh |
| 1,3-diphenyl-3-thioxo-propan-1-one |
| monothiodibenzoylmethane |
| Thiodibenzoylmethan |
| 1-Propanone,1,3-diphenyl-3-thioxo |