(R)-Methyl 3-(3'-acetylbiphenyl-4-yl)-2-aminopropanoate hydrochloride
Modify Date: 2025-09-21 07:47:01
(R)-Methyl 3-(3'-acetylbiphenyl-4-yl)-2-aminopropanoate hydrochloride structure
|
Common Name | (R)-Methyl 3-(3'-acetylbiphenyl-4-yl)-2-aminopropanoate hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1212405-82-7 | Molecular Weight | 333.80900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H20ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (R)-Methyl 3-(3'-acetylbiphenyl-4-yl)-2-aminopropanoate hydrochloride |
|---|
| Molecular Formula | C18H20ClNO3 |
|---|---|
| Molecular Weight | 333.80900 |
| Exact Mass | 333.11300 |
| PSA | 69.39000 |
| LogP | 4.10130 |
| InChIKey | LWOZEYFSFLUJDE-UNTBIKODSA-N |
| SMILES | COC(=O)C(N)Cc1ccc(-c2cccc(C(C)=O)c2)cc1.Cl |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |