5-(Bromomethyl)-3-(4-methoxyphenyl)-1,3-oxazolidin-2-one structure
|
Common Name | 5-(Bromomethyl)-3-(4-methoxyphenyl)-1,3-oxazolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 121082-86-8 | Molecular Weight | 286.12200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(Bromomethyl)-3-(4-methoxyphenyl)-1,3-oxazolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H12BrNO3 |
|---|---|
| Molecular Weight | 286.12200 |
| Exact Mass | 285.00000 |
| PSA | 38.77000 |
| LogP | 2.48030 |
| InChIKey | RZUIXWZEMZSSDT-UHFFFAOYSA-N |
| SMILES | COc1ccc(N2CC(CBr)OC2=O)cc1 |
| HS Code | 2934999090 |
|---|
|
~87%
5-(Bromomethyl)... CAS#:121082-86-8 |
| Literature: Gates, Kent S.; Silverman, Richard B. Journal of the American Chemical Society, 1989 , vol. 111, # 24 p. 8891 - 8895 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| bromomethylmethoxyphenyloxazolidinone |
| 5-(Bromomethyl)-3-(4-methoxyphenyl)-2-oxazolidinone |
| KE-0736 |
| 3-p-methoxyphenyl-5-bromomethyl-oxazolidin-2-one |