5,5-dimethyl-3-(4-trimethylsilylbut-3-ynyl)cyclohex-2-en-1-one structure
|
Common Name | 5,5-dimethyl-3-(4-trimethylsilylbut-3-ynyl)cyclohex-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 121079-98-9 | Molecular Weight | 248.43600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H24OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,5-dimethyl-3-(4-trimethylsilylbut-3-ynyl)cyclohex-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H24OSi |
|---|---|
| Molecular Weight | 248.43600 |
| Exact Mass | 248.16000 |
| PSA | 17.07000 |
| LogP | 3.96290 |
| InChIKey | AZLWZGAXEUAOJO-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)C=C(CCC#C[Si](C)(C)C)C1 |
|
~77%
5,5-dimethyl-3-... CAS#:121079-98-9 |
| Literature: Harling, J. D.; Motherwell, W. B. Journal of the Chemical Society, Chemical Communications, 1988 , # 20 p. 1380 - 1382 |
|
~%
5,5-dimethyl-3-... CAS#:121079-98-9 |
| Literature: Batey; Harling; Motherwell Tetrahedron, 1992 , vol. 48, # 37 p. 8031 - 8052 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-Cyclohexen-1-one,5,5-dimethyl-3-[4-(trimethylsilyl)-3-butynyl] |
| 5,5-dimethyl-3-(4-trimethylsilylbut-3-ynyl)cyclohex-2-enone |