Benzenesulfonamide,N-(2-methyl-5-nitrophenyl)- structure
|
Common Name | Benzenesulfonamide,N-(2-methyl-5-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 121-77-7 | Molecular Weight | 292.31000 | |
| Density | 1.414g/cm3 | Boiling Point | 457.4ºC at 760mmHg | |
| Molecular Formula | C13H12N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.4ºC | |
| Name | N-(2-methyl-5-nitrophenyl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.414g/cm3 |
|---|---|
| Boiling Point | 457.4ºC at 760mmHg |
| Molecular Formula | C13H12N2O4S |
| Molecular Weight | 292.31000 |
| Flash Point | 230.4ºC |
| Exact Mass | 292.05200 |
| PSA | 100.37000 |
| LogP | 4.38100 |
| Vapour Pressure | 1.5E-08mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | WRWMJCVKQPQKNL-UHFFFAOYSA-N |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NS(=O)(=O)c1ccccc1 |
| HS Code | 2935009090 |
|---|
|
~%
Benzenesulfonam... CAS#:121-77-7 |
| Literature: Dauphin,G. et al. Bulletin de la Societe Chimique de France, 1967 , p. 3404 - 3410 |
|
~%
Benzenesulfonam... CAS#:121-77-7 |
| Literature: Morgan; Micklethwait Journal of the Chemical Society, 1906 , vol. 89, p. 1294 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Benzenesulfonamide,N-(2-methyl-5-nitrophenyl) |
| benzenesulfonic acid-(2-methyl-5-nitro-anilide) |
| 4-Nitro-2-benzosulfamino-toluol |
| Benzolsulfon-N-(5-nitro-2-tolyl)-amid |
| 5'-Nitrobenzenesulfono-o-toluidide |
| Benzolsulfonsaeure-(2-methyl-5-nitro-anilid) |