3,5-disulphobenzoic acid
Modify Date: 2025-08-25 18:28:44
3,5-disulphobenzoic acid structure
|
Common Name | 3,5-disulphobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 121-48-2 | Molecular Weight | 282.24800 | |
| Density | 1.913g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H6O8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,5-Disulfobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.913g/cm3 |
|---|---|
| Molecular Formula | C7H6O8S2 |
| Molecular Weight | 282.24800 |
| Exact Mass | 281.95000 |
| PSA | 162.80000 |
| LogP | 2.03980 |
| Index of Refraction | 1.648 |
| InChIKey | LZRAAMHXKXNHEF-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(S(=O)(=O)O)cc(S(=O)(=O)O)c1 |
| HS Code | 2916399090 |
|---|
|
~%
3,5-disulphoben... CAS#:121-48-2 |
| Literature: Graves; Adams Journal of the American Chemical Society, 1923 , vol. 45, p. 2451 |
|
~%
3,5-disulphoben... CAS#:121-48-2 |
| Literature: Cerfontain, Hans; Zou, Yousi; Bakker, Bert H. Recueil des Travaux Chimiques des Pays-Bas, 1994 , vol. 113, # 9 p. 403 - 410 |
|
~%
3,5-disulphoben... CAS#:121-48-2 |
| Literature: Barth; Senhofer Justus Liebigs Annalen der Chemie, 1871 , vol. 159, p. 1585 |
CAS#:4142-98-7
CAS#:99-10-5
CAS#:121-91-5| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3,5-disulphobenzoic acid |
| 3,5-Disulfobenzoicacid |
| 3,5-disulfonicbenzoic acid |
| 3.5-Disulfo-benzoesaeure |
| EINECS 204-474-1 |
| Benzoesaeure-disulfonsaeure-(3.5) |
| Benzoic acid,3,5-disulfo |