Dalcotidine structure
|
Common Name | Dalcotidine | ||
|---|---|---|---|---|
| CAS Number | 120958-90-9 | Molecular Weight | 319.44200 | |
| Density | 1.075g/cm3 | Boiling Point | 516.2ºC at 760mmHg | |
| Molecular Formula | C18H29N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266ºC | |
| Name | 1-ethyl-3-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.075g/cm3 |
|---|---|
| Boiling Point | 516.2ºC at 760mmHg |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.44200 |
| Flash Point | 266ºC |
| Exact Mass | 319.22600 |
| PSA | 53.60000 |
| LogP | 3.48020 |
| Vapour Pressure | 9.15E-11mmHg at 25°C |
| Index of Refraction | 1.537 |
| InChIKey | SVCQBXMFONNZHX-UHFFFAOYSA-N |
| SMILES | CCNC(=O)NCCCOc1cccc(CN2CCCCC2)c1 |
|
~88%
Dalcotidine CAS#:120958-90-9 |
| Literature: Miyashita; Matsumoto; Matsukubo; Iinuma; Taga; Sekiguchi; Hamada; Okamura; Nishino Journal of Medicinal Chemistry, 1992 , vol. 35, # 13 p. 2446 - 2451 |
|
~%
Dalcotidine CAS#:120958-90-9 |
| Literature: Kyorin Pharmaceutical Co., Ltd. Patent: US4952591 A1, 1990 ; |
| KU 1257 |
| Dalcotidine |