(4,6-DIMETHYLPYRIMIDIN-2-YLTHIO)METHYL]METHYLCYANOCARBONIMIDODITHIOATE
Modify Date: 2025-09-12 14:24:28
![(4,6-DIMETHYLPYRIMIDIN-2-YLTHIO)METHYL]METHYLCYANOCARBONIMIDODITHIOATE Structure](https://image.chemsrc.com/caspic/276/120958-21-6.png)
(4,6-DIMETHYLPYRIMIDIN-2-YLTHIO)METHYL]METHYLCYANOCARBONIMIDODITHIOATE structure
|
Common Name | (4,6-DIMETHYLPYRIMIDIN-2-YLTHIO)METHYL]METHYLCYANOCARBONIMIDODITHIOATE | ||
|---|---|---|---|---|
| CAS Number | 120958-21-6 | Molecular Weight | 284.42400 | |
| Density | 1.31g/cm3 | Boiling Point | 433.3ºC at 760 mmHg | |
| Molecular Formula | C10H12N4S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.9ºC | |
| Name | [(4,6-dimethylpyrimidin-2-yl)sulfanylmethylsulfanyl-methylsulfanylmethylidene]cyanamide |
|---|
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 433.3ºC at 760 mmHg |
| Molecular Formula | C10H12N4S3 |
| Molecular Weight | 284.42400 |
| Flash Point | 215.9ºC |
| Exact Mass | 284.02200 |
| PSA | 137.83000 |
| LogP | 3.07628 |
| Vapour Pressure | 1.04E-07mmHg at 25°C |
| Index of Refraction | 1.659 |
| InChIKey | XFILWIUYFBQEOA-UHFFFAOYSA-N |
| SMILES | CSC(=NC#N)SCSc1nc(C)cc(C)n1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |