4-(4-fluorophenyl)-3-phenyl-5-[2-(4-phenylpiperazin-1-yl)ethyl]-1,3-oxazol-2-one structure
|
Common Name | 4-(4-fluorophenyl)-3-phenyl-5-[2-(4-phenylpiperazin-1-yl)ethyl]-1,3-oxazol-2-one | ||
|---|---|---|---|---|
| CAS Number | 120944-32-3 | Molecular Weight | 443.51300 | |
| Density | 1.247g/cm3 | Boiling Point | 584.6ºC at 760 mmHg | |
| Molecular Formula | C27H26FN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307.4ºC | |
| Name | 4-(4-fluorophenyl)-3-phenyl-5-[2-(4-phenylpiperazin-1-yl)ethyl]-1,3-oxazol-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.247g/cm3 |
|---|---|
| Boiling Point | 584.6ºC at 760 mmHg |
| Molecular Formula | C27H26FN3O2 |
| Molecular Weight | 443.51300 |
| Flash Point | 307.4ºC |
| Exact Mass | 443.20100 |
| PSA | 41.62000 |
| LogP | 4.60420 |
| Vapour Pressure | 1.18E-13mmHg at 25°C |
| Index of Refraction | 1.62 |
| InChIKey | ZWFICUBKYMXFCW-UHFFFAOYSA-N |
| SMILES | O=c1oc(CCN2CCN(c3ccccc3)CC2)c(-c2ccc(F)cc2)n1-c1ccccc1 |
|
~%
4-(4-fluorophen... CAS#:120944-32-3 |
| Literature: Cascio, Giuseppe; Manghisi, Elso; Fregnan, Giancarlo Journal of Medicinal Chemistry, 1989 , vol. 32, # 10 p. 2241 - 2247 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-(4-Fluorophenyl)-3-phenyl-5-(2-(4-phenyl-1-piperazinyl)ethyl)-2(3H)-oxazolone |
| 4-(4-fluoro-phenyl)-3-phenyl-5-[2-(4-phenyl-piperazin-1-yl)-ethyl]-3H-oxazol-2-one |
| 2(3H)-Oxazolone,4-(4-fluorophenyl)-3-phenyl-5-(2-(4-phenyl-1-piperazinyl)ethyl) |