tert-Butyl 4-(3-aminopyrazin-2-yl)piperazine-1-carboxylate
Modify Date: 2025-08-25 21:39:46
tert-Butyl 4-(3-aminopyrazin-2-yl)piperazine-1-carboxylate structure
|
Common Name | tert-Butyl 4-(3-aminopyrazin-2-yl)piperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1208542-95-3 | Molecular Weight | 279.338 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 448.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C13H21N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.9±28.7 °C | |
| Name | tert-butyl 4-(3-aminopyrazin-2-yl)piperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 448.2±45.0 °C at 760 mmHg |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.338 |
| Flash Point | 224.9±28.7 °C |
| Exact Mass | 279.169525 |
| PSA | 84.58000 |
| LogP | 1.33 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | TVVMFRXXKIFECN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2nccnc2N)CC1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methyl-2-propanyl 4-(3-amino-2-pyrazinyl)-1-piperazinecarboxylate |
| 2-Amino-3-(4-tert-butoxycarbonylpiperazin-1-yl)pyrazine |
| 2-Amino-3-(4-Boc-piperazin-1-yl)pyrazine |
| tert-Butyl 4-(3-aminopyrazin-2-yl)piperazine-1-carboxylate |
| 1,1-Dimethylethyl 4-(3-amino-2-pyrazinyl)-1-piperazinecarboxylate |
| 1-Piperazinecarboxylic acid, 4-(3-amino-2-pyrazinyl)-, 1,1-dimethylethyl ester |