1-(Trifluoromethoxy)-N-[3-(trifluoromethyl)benzyl]-2-butanamine
Modify Date: 2025-09-18 18:17:57
![1-(Trifluoromethoxy)-N-[3-(trifluoromethyl)benzyl]-2-butanamine Structure](https://image.chemsrc.com/caspic/156/1208079-99-5.png)
1-(Trifluoromethoxy)-N-[3-(trifluoromethyl)benzyl]-2-butanamine structure
|
Common Name | 1-(Trifluoromethoxy)-N-[3-(trifluoromethyl)benzyl]-2-butanamine | ||
|---|---|---|---|---|
| CAS Number | 1208079-99-5 | Molecular Weight | 315.25500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15F6NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(Trifluoromethoxy)-N-[3-(trifluoromethyl)benzyl]-2-butanamine |
|---|
| Molecular Formula | C13H15F6NO |
|---|---|
| Molecular Weight | 315.25500 |
| Exact Mass | 315.10600 |
| PSA | 21.26000 |
| LogP | 4.50090 |
| InChIKey | FSBXYXLKVFTKKC-UHFFFAOYSA-N |
| SMILES | CCC(COC(F)(F)F)NCc1cccc(C(F)(F)F)c1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |