6-Amino-1,3,3-triMethyl-2-oxoindoline structure
|
Common Name | 6-Amino-1,3,3-triMethyl-2-oxoindoline | ||
|---|---|---|---|---|
| CAS Number | 120791-60-8 | Molecular Weight | 190.24200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-amino-1,3,3-trimethylindol-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H14N2O |
|---|---|
| Molecular Weight | 190.24200 |
| Exact Mass | 190.11100 |
| PSA | 46.33000 |
| LogP | 2.16900 |
| InChIKey | REGFWMJGPPJKKI-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(C)(C)c2ccc(N)cc21 |
|
~99%
6-Amino-1,3,3-t... CAS#:120791-60-8 |
| Literature: Saal, Wolfgang von der; Hoelck, Jens-Peter; Kampe, Wolfgang; Mertens, Alfred; Mueller-Beckmann, Bernd Journal of Medicinal Chemistry, 1989 , vol. 32, # 7 p. 1481 - 1491 |
|
~%
6-Amino-1,3,3-t... CAS#:120791-60-8 |
| Literature: Saal, Wolfgang von der; Hoelck, Jens-Peter; Kampe, Wolfgang; Mertens, Alfred; Mueller-Beckmann, Bernd Journal of Medicinal Chemistry, 1989 , vol. 32, # 7 p. 1481 - 1491 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6-AMINO-1,3,3-TRIMETHYL-2,3-DIHYDRO-1H-INDOL-2-ONE |
| 6-Amino-1,3,3-trimethyl-2-oxoindoline |
| 6-amino-1,3,3-trimethyl-2-indolone |
| 6-Amino-1,3-dihydro-1,3,3-trimethyl-2H-indol-2-one |
| 6-azanyl-1,3,3-trimethyl-indol-2-one |
| 6-amino-1,3,3-trimethylindolin-2-one |