2-Acetamido-4-chloro-5-methylbenzoic acid structure
|
Common Name | 2-Acetamido-4-chloro-5-methylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1204312-39-9 | Molecular Weight | 227.64400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Acetamido-4-chloro-5-methylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H10ClNO3 |
|---|---|
| Molecular Weight | 227.64400 |
| Exact Mass | 227.03500 |
| PSA | 69.89000 |
| LogP | 2.95450 |
| InChIKey | IKWNCQRFCPAMKG-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc(Cl)c(C)cc1C(=O)O |
|
~81%
2-Acetamido-4-c... CAS#:1204312-39-9 |
| Literature: Journal of the American Chemical Society, , vol. 132, # 2 p. 686 - 693 |
|
~%
2-Acetamido-4-c... CAS#:1204312-39-9 |
| Literature: Journal of Medicinal Chemistry, , vol. 53, # 24 p. 8734 - 8746 |
| 4-chloro-5-methyl-N-acetylanthranilic acid |
| 4-chloro-5-methylindoline |
| 1H-Indole,4-chloro-2,3-dihydro-5-methyl |