12-hydroxyjasmonic acid 12-O-β-D-glucoside structure
|
Common Name | 12-hydroxyjasmonic acid 12-O-β-D-glucoside | ||
|---|---|---|---|---|
| CAS Number | 120399-24-8 | Molecular Weight | 388.41000 | |
| Density | 1.302g/cm3 | Boiling Point | 605.556ºC at 760 mmHg | |
| Molecular Formula | C18H28O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.557ºC | |
| Name | 12-hydroxyjasmonic acid 12-O-β-D-glucoside |
|---|---|
| Synonym | More Synonyms |
| Density | 1.302g/cm3 |
|---|---|
| Boiling Point | 605.556ºC at 760 mmHg |
| Molecular Formula | C18H28O9 |
| Molecular Weight | 388.41000 |
| Flash Point | 211.557ºC |
| Exact Mass | 388.17300 |
| PSA | 153.75000 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | JFDNMLUPLXZXGV-RKAGECJXSA-N |
| SMILES | O=C(O)CC1CCC(=O)C1CC=CCCOC1OC(CO)C(O)C(O)C1O |
|
~%
12-hydroxyjasmo... CAS#:120399-24-8 |
| Literature: Kikuzaki, Hiroe; Miyajima, Yoshiko; Nakatani, Nobuji Journal of Natural Products, 2008 , vol. 71, # 5 p. 861 - 865 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Tuberonic acid glucoside |
| 2-[(1R,2R)-3-oxo-2-[(Z)-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypent-2-enyl]cyclopentyl]acetic acid |
| 12-hydroxyjasmonic acid 12-O-beta-D-glucoside |