3-amino-2,6-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one
Modify Date: 2025-09-27 18:08:43
![3-amino-2,6-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one Structure](https://image.chemsrc.com/caspic/290/120354-20-3.png)
3-amino-2,6-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one structure
|
Common Name | 3-amino-2,6-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 120354-20-3 | Molecular Weight | 249.33200 | |
| Density | 1.53g/cm3 | Boiling Point | 467.6ºC at 760 mmHg | |
| Molecular Formula | C12H15N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.6ºC | |
| Name | 3-amino-2,6-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|
| Density | 1.53g/cm3 |
|---|---|
| Boiling Point | 467.6ºC at 760 mmHg |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.33200 |
| Flash Point | 236.6ºC |
| Exact Mass | 249.09400 |
| PSA | 89.15000 |
| LogP | 2.18620 |
| Vapour Pressure | 6.41E-09mmHg at 25°C |
| Index of Refraction | 1.767 |
| InChIKey | XUQSYCHZJHLNTF-UHFFFAOYSA-N |
| SMILES | Cc1nc2sc3c(c2c(=O)n1N)CC(C)CC3 |
|
~45%
3-amino-2,6-dim... CAS#:120354-20-3 |
| Literature: Perrissin; Favre; Luu Duc; Huguet; Gaultier; Narcisse European Journal of Medicinal Chemistry, 1988 , vol. 23, # 5 p. 453 - 456 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |